| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | benzyldimethyloctylammonium chloride Basic information |
| | benzyldimethyloctylammonium chloride Chemical Properties |
| form | powder | | BRN | 3771220 | | Cosmetics Ingredients Functions | HAIR CONDITIONING | | InChI | 1S/C17H30N.ClH/c1-4-5-6-7-8-12-15-18(2,3)16-17-13-10-9-11-14-17;/h9-11,13-14H,4-8,12,15-16H2,1-3H3;1H/q+1;/p-1 | | InChIKey | PXFDQFDPXWHEEP-UHFFFAOYSA-M | | SMILES | [Cl-].CCCCCCCC[N+](C)(C)Cc1ccccc1 | | EPA Substance Registry System | Benzenemethanaminium, N,N-dimethyl-N-octyl-, chloride (959-55-7) |
| Hazard Codes | C,N | | Risk Statements | 21/22-34-50 | | Safety Statements | 36/37/39-45-61 | | RIDADR | UN 2923 8/PG 3 | | WGK Germany | 3 | | RTECS | BO7040000 | | TSCA | TSCA listed | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Aquatic Acute 1
Skin Corr. 1B | | Toxicity | skn-rbt 1 mg/24H OYYAA2 6,329,72 |
| | benzyldimethyloctylammonium chloride Usage And Synthesis |
| Safety Profile | A skin and eye irritant. Whenheated to decomposition it emits very toxic fumes ofNOx, NH3, and Clí. |
| | benzyldimethyloctylammonium chloride Preparation Products And Raw materials |
|