| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | bis(dibutyldithiocarbamato-S,S')copper Basic information |
| Product Name: | bis(dibutyldithiocarbamato-S,S')copper | | Synonyms: | Copper, bis(dibutylcarbamodithioato-.kappa.S,.kappa.S)-, (SP-4-1)-;Cupric dibutyldithiocarbamate;Bis(dibutyldithiocarbamato)copper;Bis(N,N-dibutyldithiocarbamato)copper;Copper bis(dibutyldithiocarbamate);Copper(2+) dibutyldithiocarbamate;NSC 22318;Copper dibuthyldithiocarbarMate | | CAS: | 13927-71-4 | | MF: | C18H36CuN2S4 | | MW: | 472.306 | | EINECS: | 237-695-7 | | Product Categories: | | | Mol File: | 13927-71-4.mol |  |
| | bis(dibutyldithiocarbamato-S,S')copper Chemical Properties |
| Melting point | 60-61 °C | | Boiling point | 484.97°C (estimate) | | density | 60-61 | | vapor pressure | 0Pa at 25℃ | | storage temp. | Store at room temperature, keep dry and cool | | Appearance | Brown to black Solid | | Water Solubility | 1μg/L at 20℃ | | InChI | InChI=1S/2C9H19NS2.Cu/c2*1-3-5-7-10(9(11)12)8-6-4-2;/h2*3-8H2,1-2H3,(H,11,12);/q;;+2/p-2 | | InChIKey | IXPUJMULXNNEHS-UHFFFAOYSA-L | | SMILES | N(CCCC)(CCCC)C(=S)S[Cu]SC(=S)N(CCCC)CCCC | | LogP | 4.7 | | EPA Substance Registry System | Copper, bis(N,N-dibutylcarbamodithioato-.kappa.S,.kappa.S')-, (SP-4-1)- (13927-71-4) |
| | bis(dibutyldithiocarbamato-S,S')copper Usage And Synthesis |
| Uses | Agricultural chemical. | | Hazard | Moderately toxic by ingestion. | | Flammability and Explosibility | Non flammable |
| | bis(dibutyldithiocarbamato-S,S')copper Preparation Products And Raw materials |
|