| Company Name: |
Pharmavoyager Gold |
| Tel: |
15351203386 |
| Email: |
2592141051@qq.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester Basic information |
| Product Name: | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester | | Synonyms: | (R)-1-N-Boc-piperazine-3-carboxylic acid methyl ester;Methyl (R)-1-N-Boc-piperazine-3-carboxylate;REF DUPL: (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester;（R)-1-N-Boc-3-piperazinecarboxylic acid methyl ester;(R)-4-tert-butyloxypiperazine-2-carboxylic acid Methyl ester;1,3-Piperazinedicarboxylic acid, 1-(1,1-dimethylethyl) 3-methyl ester, (3R)-;Methyl (R)-4-Boc-piperazine-2-carboxylate;(R)-4-N-Boc-piperazine-2-carboxylic acid Methyl ester 96% | | CAS: | 438631-77-7 | | MF: | C11H20N2O4 | | MW: | 244.29 | | EINECS: | | | Product Categories: | Piperaizine | | Mol File: | 438631-77-7.mol |  |
| | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 321.3±37.0 °C(Predicted) | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 6.45±0.40(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(15)13-6-5-12-8(7-13)9(14)16-4/h8,12H,5-7H2,1-4H3/t8-/m1/s1 | | InChIKey | QUKAHFCVKNRRBU-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN[C@@H](C(OC)=O)C1 |
| | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester Usage And Synthesis |
| Uses | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester is used for organic synthesis. | | storage | Keep in dark place,Inert atmosphere,2-8°C |
| | (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|