2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose manufacturers
|
| | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose Basic information |
| Product Name: | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose | | Synonyms: | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactopyranose;2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactopyranoside;2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose;2-(AcetylaMino)-2-deoxy-4,6-O-(phenylMethylene)-D-galactose;N-(6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl)acetamide;N-((1R,2R)-1-Hydroxy-1-((4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl)-3-oxopropan-2-yl)acetamide;D-Galactose, 2-(acetylamino)-2-deoxy-4,6-O-(phenylmethylene)-;4,6-O-benzylidene-N-ethanoyl-D-galactosamine | | CAS: | 420118-03-2 | | MF: | C15H19NO6 | | MW: | 309.31 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 420118-03-2.mol |  |
| | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose Chemical Properties |
| Melting point | 214-215°C | | Boiling point | 601.2±55.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in DMSO | | form | Solid | | pka | 13.01±0.20(Predicted) | | color | White | | InChI | 1S/C15H19NO6/c1-8(17)16-11-12(18)13-10(21-14(11)19)7-20-15(22-13)9-5-3-2-4-6-9/h2-6,10-15,18-19H,7H2,1H3,(H,16,17)/t10-,11-,12-,13+,14,15/m1/s1 | | InChIKey | OIXDAEIOQFFRMF-YNBGEIFUSA-N | | SMILES | O=C(C)N[C@@H](C(O)O1)[C@@H](O)[C@@]([C@@]1([H])CO2)([H])OC2C3=CC=CC=C3 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2-(Acetylamino)-2-deoxy-4,6-O-(phenylmethylene)-D-galactose is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactose Preparation Products And Raw materials |
|