|
|
| | Palmitoyl Tetrapeptide-3 Basic information |
| Product Name: | Palmitoyl Tetrapeptide-3 | | Synonyms: | PALMITOYL TETRAPEPTIDE-3;Tetrapeptide-21/Tegopep;Tego pep;Cosmetic Grade Product Palmitoyl Tetrapeptide-3 powder;PalmitoylTetrapeptide-3/Rigin,PalmitoylTetrapeptide-7;L-Lysine,L-prolyl-L-lysyl-L-α-glutamyl-,acetate(1:3);PalmitoylTetrapeptide-3/Rigin;H-Pro-Lys-Glu-Lys-NH2 | | CAS: | 1228558-05-1 | | MF: | C24H44N6O9 | | MW: | 560.65 | | EINECS: | 000-000-0 | | Product Categories: | Cosmetics beauty peptide | | Mol File: | 1228558-05-1.mol |  |
| | Palmitoyl Tetrapeptide-3 Chemical Properties |
| Sequence | Palm-Gly-Gln-Pro-Arg-OH | | InChIKey | JQJKOEZUZYXNSZ-HBJNQDQPNA-N | | SMILES | C(=O)(O)C.[C@@H](CCCCN)(NC([C@H]1NCCC1)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)O)CCCCN |&1:4,12,21,30,r| |
| | Palmitoyl Tetrapeptide-3 Usage And Synthesis |
| Uses | anti-wrikle | | benefits |
Palmitoyl tetrapeptide-3 is a signaling peptide that can promote the synthesis of matrix proteins, especially collagen, and may also promote the formation of elastin, hyaluronic acid, glycosamine Chemicalbook and fipronectin. Palmitoyl tetrapeptide-3 has significant anti-eyelid puffiness, eliminates eye bags and anti-inflammation, enhances the skin's tolerance to the external environment, and increases the defense against pollution.
|
| | Palmitoyl Tetrapeptide-3 Preparation Products And Raw materials |
|