Methyl(R)-N-Boc-3-aminobutyrate manufacturers
|
| | Methyl(R)-N-Boc-3-aminobutyrate Basic information |
| Product Name: | Methyl(R)-N-Boc-3-aminobutyrate | | Synonyms: | (R)-3-[[(1,1-DiMethylethoxy)carbonyl]aMino]butanoic acid Methyl ester;Butanoic acid, 3-[[(1,1-diMethylethoxy)carbonyl]aMino]-, Methyl ester, (R)-;Butanoic acid, 3-[[(1,1-diMethylethoxy)carbonyl]aMino]-, Methyl ester, (3R)-;(R)-N-BOC-3-Aminobutyric acid ethyl ester;methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;Boc-(R)-3-AMINO-BUTYRIC ACID METHYL ESTER;(R)-Methyl 3-((tert-butoxycarbonyl)amino)butanoate;(R)-3-tert-Butoxycarbonylamino-butyric acid methyl ester | | CAS: | 159877-47-1 | | MF: | C10H19NO4 | | MW: | 217.26 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 159877-47-1.mol |  |
| | Methyl(R)-N-Boc-3-aminobutyrate Chemical Properties |
| Boiling point | 302.8±25.0 °C(Predicted) | | density | 1.035±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.77±0.46(Predicted) | | Appearance | White Solid | | InChI | InChI=1S/C10H19NO4/c1-7(6-8(12)14-5)11-9(13)15-10(2,3)4/h7H,6H2,1-5H3,(H,11,13)/t7-/m1/s1 | | InChIKey | SUHJJLDEYCLBFT-SSDOTTSWSA-N | | SMILES | C(OC)(=O)C[C@H](NC(OC(C)(C)C)=O)C |
| | Methyl(R)-N-Boc-3-aminobutyrate Usage And Synthesis |
| | Methyl(R)-N-Boc-3-aminobutyrate Preparation Products And Raw materials |
|