- Boc-Asp(OcHx)-OH
-
-
2026-08-08
- CAS:73821-95-1
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
- Boc-Asp(Ochx)-OH
-
- $1.10
-
2025-06-25
- CAS:73821-95-1
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
- Boc-Asp(Ochx)-OH
-
- $500.00
-
2019-07-06
- CAS:73821-95-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10tons
|
| | Boc-Asp(Ochx)-OH Basic information |
| | Boc-Asp(Ochx)-OH Chemical Properties |
| Melting point | 93-95 °C | | Boiling point | 487.2±40.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 3.66±0.23(Predicted) | | form | Powder | | color | White | | Optical Rotation | [α]20/D 21.0±1.5°, c = 2% in DMF | | BRN | 3563576 | | Major Application | peptide synthesis | | InChI | 1S/C15H25NO6/c1-15(2,3)22-14(20)16-11(13(18)19)9-12(17)21-10-7-5-4-6-8-10/h10-11H,4-9H2,1-3H3,(H,16,20)(H,18,19)/t11-/m0/s1 | | InChIKey | NLPQIWFEEKQBBN-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC1CCCCC1)C(O)=O | | CAS DataBase Reference | 73821-95-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | Boc-Asp(Ochx)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-L-Asp(OcHx)-OH, is an aspartic acid derivative, that can be used in various chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-Asp(Ochx)-OH Preparation Products And Raw materials |
|