| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 2-(4-Boc-aminopiperidin-1-yl)-2-(furan-& Basic information |
| | 2-(4-Boc-aminopiperidin-1-yl)-2-(furan-& Chemical Properties |
| Melting point | 218 °C (dec.)(lit.) | | Boiling point | 435.1±45.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | form | solid | | pka | 1.84±0.10(Predicted) | | InChI | 1S/C16H24N2O5/c1-16(2,3)23-15(21)17-11-6-8-18(9-7-11)13(14(19)20)12-5-4-10-22-12/h4-5,10-11,13H,6-9H2,1-3H3,(H,17,21)(H,19,20) | | InChIKey | YPMFFOGSMOXXLA-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NC1CCN(CC1)C(C(O)=O)c2ccco2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(4-Boc-aminopiperidin-1-yl)-2-(furan-& Usage And Synthesis |
| | 2-(4-Boc-aminopiperidin-1-yl)-2-(furan-& Preparation Products And Raw materials |
|