| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:4-(Boc-piperazin-1-yl)-3-nitrobenzoic acid CAS:870703-72-3 Purity:97% Package:1G Remarks:651923-1G
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 400-867-5858;400-867-5858 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:1-Piperazinecarboxylic acid, 4-(4-carboxy-2-nitrophenyl)-, 1-(1,1-dimethylethyl) ester CAS:870703-72-3 Purity:97% HPLC Package:5g;25g;100g;1kg
|
| Company Name: |
Shanghai Haohong Scientific Co., Ltd.
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:4-(4-(tert-butoxycarbonyl)piperazin-1-yl)-3-nitrobenzoic acid CAS:870703-72-3 Purity:98%
|
|
| | 4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& Basic information |
| Product Name: | 4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& | | Synonyms: | 1-Boc-4-(4-carboxy-2-nitrophenyl)piperazine, 4-[(tert-Butoxycarbonyl)-piperazin-1-yl]-3-nitrobenzoic acid;1-Piperazinecarboxylic acid, 4-(4-carboxy-2-nitrophenyl)-, 1-(1,1-dimethylethyl) ester;4-(4-(tert-Butoxycarbonyl)piperazin-1-yl)-3-nitrobenzoic acid | | CAS: | 870703-72-3 | | MF: | C16H21N3O6 | | MW: | 351.35 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 870703-72-3.mol |  |
| | 4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& Chemical Properties |
| Melting point | 199-203 °C (dec.)(lit.) | | Boiling point | 529.2±50.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | pka | 4.48±0.10(Predicted) | | form | solid | | InChI | 1S/C16H21N3O6/c1-16(2,3)25-15(22)18-8-6-17(7-9-18)12-5-4-11(14(20)21)10-13(12)19(23)24/h4-5,10H,6-9H2,1-3H3,(H,20,21) | | InChIKey | CYGRJUZYSXUAMM-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)c2ccc(cc2[N+]([O-])=O)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& Usage And Synthesis |
| | 4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& Preparation Products And Raw materials |
|