| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DUTP, 100MM SOLUTION Basic information |
| Product Name: | DUTP, 100MM SOLUTION | | Synonyms: | DUTP, 100MM SOLUTION;2'-deoxyuridine 5'-triphosphate sodium salt solution;2μ-Deoxyuridine 5μ-triphosphate solution sodium salt;Diquafosol Impurity 14;[[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate;dUTP sodium;2'-deoxyuridine triphosphate Sodium;2'-DEOXYURIDINE 5'-TRIPHOSPHATE SODIUM SALT SOLUT... | | CAS: | 94736-09-1 | | MF: | C9H16N2NaO14P3 | | MW: | 492.14 | | EINECS: | | | Product Categories: | | | Mol File: | 94736-09-1.mol |  |
| | DUTP, 100MM SOLUTION Chemical Properties |
| storage temp. | -20°C | | form | solution | | color | colorless | | InChIKey | FVFWWPFKJNTHIQ-UHFFFAOYSA-N | | SMILES | [Na].OC1CC(OC1COP(O)(=O)OP(O)(=O)OP(O)(O)=O)N2C=CC(=O)NC2=O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | DUTP, 100MM SOLUTION Usage And Synthesis |
| Uses | dUTP, PCR Grade, is suitable for many applications where high-quality reagents are required. Avoid carryover contamination between PCRs to eliminate a source of false positives. | | General Description | dUTP, PCR Grade, is a 100 mM clear, colorless solution of the sodium salt (pH 8.3). |
| | DUTP, 100MM SOLUTION Preparation Products And Raw materials |
|