|
|
| | tert-Butyl (1-(2-hydroxyethyl)cyclopropyl)carbamate Basic information |
| Product Name: | tert-Butyl (1-(2-hydroxyethyl)cyclopropyl)carbamate | | Synonyms: | Carbamic acid, [1-(2-hydroxyethyl)cyclopropyl]-, 1,1-dimethylethyl ester (9CI);CarbaMic acid, [1-(2-hydroxyethyl)cyclopropyl]-, 1,1-diMethylethyl ester;tert-butyl 1-(2-hydroxyethyl)cyclopropylcarbamate;N-Boc-1-(2-hydroxyethyl)cyclopropanamine;tert-butyl N-[1-(2-hydroxyethyl)cyclopropyl]carbamate;1-(2-Hydroxy-ethyl)-cyclopropyl]-carbamic acid tert-butyl ester;2-[1-(Boc-amino)cyclopropyl]ethanol;Carbamic acid, N-[1-(2-hydroxyethyl)cyclopropyl]-, 1,1-dimethylethyl ester | | CAS: | 753023-57-3 | | MF: | C10H19NO3 | | MW: | 201.26 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 753023-57-3.mol |  |
| | tert-Butyl (1-(2-hydroxyethyl)cyclopropyl)carbamate Chemical Properties |
| Boiling point | 310.0±11.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.62±0.20(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H19NO3/c1-9(2,3)14-8(13)11-10(4-5-10)6-7-12/h12H,4-7H2,1-3H3,(H,11,13) | | InChIKey | ZYKQKYDJZPJMEF-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1(CCO)CC1 |
| | tert-Butyl (1-(2-hydroxyethyl)cyclopropyl)carbamate Usage And Synthesis |
| Description | tert-Butyl (1-(2-hydroxyethyl)cyclopropyl)carbamate is a pharmaceutical intermediate compound. Its molecular structure contains a tert-butoxycarbonyl (Boc) group and a cyclopropane ring substituted with a hydroxyethyl group. The Boc group is a classic protecting group for amino groups and can be selectively deprotected in subsequent synthesis. The hydroxyl group in the hydroxyethyl moiety can be used to introduce various functional groups via reactions such as etherification, esterification and oxidation, whilst the three-membered cyclopropyl ring structure can modulate the molecular conformation and lipophilicity, enabling the construction of drug molecules containing cyclopropylamine fragments (such as antibacterial, anti-inflammatory and centrally active drugs). | | Uses | Carbamic acid, [1-(2-hydroxyethyl)cyclopropyl]-, 1,1-dimethylethyl ester (9CI) is a hydrocarbon derivative used in organic synthesis.
| | Hazard |
Carbamic acid, [1-(2-hydroxyethyl)cyclopropyl]-, 1,1-dimethylethyl ester (9CI) causes skin irritation and serious eye irritation.It is harmful if swallowed.
| | Chemical Reactivity | Tert-butyl N-[1-(2-hydroxyethyl)cyclopropyl]carbamate reacts with strong oxidizing agents, it's thermal decomposition can lead to release of irritating gases and vapors.
|
| | tert-Butyl (1-(2-hydroxyethyl)cyclopropyl)carbamate Preparation Products And Raw materials |
|