|
|
| | AMENTOFLAVONE Basic information |
| Product Name: | AMENTOFLAVONE | | Synonyms: | 8,3''-Biapigenin;5,5',7,7'-Tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-4H,4'H-[3,8'-bichroMene]-4,4'-dione;5,5′,7,7′-Tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-[3,8′-bi-4H-1-benzopyran]-4,4′-dione;[3,8'-Bi-4H-1-benzopyran]-4,4'-dione, 5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-;I3,II8-Biapigenin-RM;3,8''-Biapigenin;Biapigenin | | CAS: | 101140-06-1 | | MF: | C30H18O10 | | MW: | 538.46 | | EINECS: | | | Product Categories: | | | Mol File: | 101140-06-1.mol |  |
| | AMENTOFLAVONE Chemical Properties |
| Melting point | 258-260 °C | | Boiling point | 911.7±65.0 °C(Predicted) | | density | 1.672±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Alcohol: soluble | | pka | 5.57±0.40(Predicted) | | form | Solid | | color | Light yellow to yellow | | BRN | 1415589 | | Major Application | food and beverages | | InChI | 1S/C30H18O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-12,31-36H | | InChIKey | IQAMTZLKUHMPPE-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1)C2=CC(=O)c3c(O)cc(O)c(c3O2)C4=C(Oc5cc(O)cc(O)c5C4=O)c6ccc(O)cc6 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | AMENTOFLAVONE Usage And Synthesis |
| Uses | I3,II8-Biapigenin may be used as an analytical reference standard for the quantification of the analyte in Hypericum perforatum extract using different chromatography techniques.', 'Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | | Definition | ChEBI: 4',4''',5,5'',7,7''-Hexahydroxy-3,8''-biflavone is a flavonoid oligomer. |
| | AMENTOFLAVONE Preparation Products And Raw materials |
|