|
|
| | Thieno[3,2-d]pyrimidine, 4-chloro-2-methyl- Basic information |
| | Thieno[3,2-d]pyrimidine, 4-chloro-2-methyl- Chemical Properties |
| Boiling point | 208℃ | | density | 1.445 | | Fp | 80℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.99±0.40(Predicted) | | form | solid | | color | Yellow | | InChI | InChI=1S/C7H5ClN2S/c1-4-9-5-2-3-11-6(5)7(8)10-4/h2-3H,1H3 | | InChIKey | OSAOHHSXWALXET-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Cl)=C2SC=CC2=N1 |
| Hazard Codes | T | | Risk Statements | 25-36 | | Safety Statements | 26-45 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | Thieno[3,2-d]pyrimidine, 4-chloro-2-methyl- Usage And Synthesis |
| | Thieno[3,2-d]pyrimidine, 4-chloro-2-methyl- Preparation Products And Raw materials |
|