Cladosporin manufacturers
- Cladosporin
-
-
2026-07-08
- CAS:35818-31-6
- Purity:
- Supply Ability: 10g
|
| | Cladosporin Basic information |
| Product Name: | Cladosporin | | Synonyms: | Cladosporin;(3R)-3β-[[(2R)-6α-Methyltetrahydro-2H-pyran-2β-yl]methyl]-6,8-dihydroxy-3,4-dihydro-1H-2-benzopyran-1-one;(R)-3,4-Dihydro-3-[[(2R,6S)-6-methyltetrahydro-2H-pyran-2-yl]methyl]-6,8-dihydroxy-1H-2-benzopyran-1-one;(R)-3,4-Dihydro-6,8-dihydroxy-3-[[(2R)-tetrahydro-6α-methyl-2H-pyran-2-yl]methyl]-1H-2-benzopyran-1-one;Asperentin;1H-2-Benzopyran-1-one, 3,4-dihydro-6,8-dihydroxy-3-[[(2R,6S)-tetrahydro-6-methyl-2H-pyran-2-yl]methyl]-, (3R)- | | CAS: | 35818-31-6 | | MF: | C16H20O5 | | MW: | 292.33 | | EINECS: | | | Product Categories: | | | Mol File: | 35818-31-6.mol |  |
| | Cladosporin Chemical Properties |
| Melting point | 181 - 184°C | | Boiling point | 543.4±45.0 °C(Predicted) | | density | 1.261±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly) | | pka | 8.09±0.40(Predicted) | | form | Solid | | color | Off-White to Pale Brown | | InChI | InChI=1S/C16H20O5/c1-9-3-2-4-12(20-9)8-13-6-10-5-11(17)7-14(18)15(10)16(19)21-13/h5,7,9,12-13,17-18H,2-4,6,8H2,1H3/t9-,12+,13+/m0/s1 | | InChIKey | WOMKDMUZNBFXKG-ZWKOPEQDSA-N | | SMILES | [C@@H]1(C[C@@H]2O[C@@H](C)CCC2)OC(=O)C2=C(O)C=C(O)C=C2C1 |
| | Cladosporin Usage And Synthesis |
| Uses | Cladosporin is an antimalarial drug and an inhibitor of Plasmodium falciparum lysyl-tRNA synthetase. | | Definition | ChEBI: A member of the class of isocoumarins that is 6,8-dihydroxy-3,4-dihydro-1H-isochromen-1-one substituted by a [6-methyltetrahydro-2H-pyran-2-yl]methyl group at position 3. It has been isolated from the fungus Cha
tomium globosum and Aspergillus flavus. |
| | Cladosporin Preparation Products And Raw materials |
|