|
|
| | β-sesquiphellandrene Basic information |
| Product Name: | β-sesquiphellandrene | | Synonyms: | β-sesquiphellandrene;(R)-3-[(S)-1,5-Dimethyl-4-hexenyl]-6-methylenecyclohexene;(R)-3β-[(S)-1,5-Dimethyl-4-hexenyl]-6-methylenecyclohexene;(R)-3-Methylene-6-((S)-6-methylhept-5-en-2-yl)-cyclohex-1-ene;(-)-Β-SESQUIPHELLANDRENE;Cyclohexene, 3-[(1S)-1,5-dimethyl-4-hexen-1-yl]-6-methylene-, (3R)-;3-Methylene-6-(6-methylhept-5-en-2-yl)-cyclohex-1-ene;(-)-&beta | | CAS: | 20307-83-9 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | 20307-83-9.mol |  |
| | β-sesquiphellandrene Chemical Properties |
| Boiling point | 90-90.5 °C(Press: 1 Torr) | | density | 0.8760 g/cm3(Temp: 25 °C) | | storage temp. | Amber Vial, Refrigerator, Under inert atmosphere | | solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Odor | at 100.00 %. herbal fruity woody | | Odor Type | herbal | | Stability: | Light sensitive | | InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8,10,14-15H,3,5,7,9,11H2,1-2,4H3/t14-,15+/m0/s1 | | InChIKey | PHWISBHSBNDZDX-LSDHHAIUSA-N | | SMILES | C1C(=C)CC[C@H]([C@@H](C)CC/C=C(/C)\C)C=1 | | LogP | 6.522 (est) |
| | β-sesquiphellandrene Usage And Synthesis |
| Uses | (-)-β-Sesquiphellandrene are found in Tanacetum vulgare plants. It is also an essential leaf and flower oils in Heracleum species. | | Definition | ChEBI: A sesquiterpene that is cyclohexene in which the hydrogens at position 6 are replaced by a methylidene group and in which the pro-R hydrogen at position 3 is replaced by a (2S)-6-methylhept-5-en-2-yl group. |
| | β-sesquiphellandrene Preparation Products And Raw materials |
|