|
|
| | Fmoc-N-Me-Tyr(tBu)-OH Basic information |
| | Fmoc-N-Me-Tyr(tBu)-OH Chemical Properties |
| Melting point | 186-191°C | | Boiling point | 638.9±55.0 °C(Predicted) | | density | 1.208 | | storage temp. | 2-8°C | | form | powder or crystals | | pka | 2.98±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]22/D -49.0°, c = 0.5% in DMF | | Major Application | peptide synthesis | | InChIKey | WTLSDEYZKFJXFT-SANMLTNESA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(OC(C)(C)C)C=C1)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C | | CAS DataBase Reference | 133373-24-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-Me-Tyr(tBu)-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | General Description | Fmoc-N-Me-Tyr(tBu)-OH is an Fmoc protected tyrosine derivative that is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Tyrosine is a very important amino acid - one of the few amino acids which is phosphorylated to vary the physical properties of the peptides, and is a precursor for the formation of iodinated thyroid hormones. The Fmoc group is typically removed with a base such as pyridine - an orthogonal de-protection strategy to the acid labilie Boc group. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis | | Synthesis | (9H-Fluoren-9-yl)methyl carbonochloridate could be used as the starting material to synthesize Fmoc-N-Me-Tyr(tBu)-OH.
 |
| | Fmoc-N-Me-Tyr(tBu)-OH Preparation Products And Raw materials |
|