- 3-Nitro-7-azaindole
-
- $9.80 / 1.79999995231628KG
-
2020-01-13
- CAS:23709-47-9
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | 3-Nitro-7-azaindole Basic information |
| Product Name: | 3-Nitro-7-azaindole | | Synonyms: | 3-NITRO-7-AZAINDOLE;3-nitro-1H-pyrrolo[2,3-b]pyridine;1H-Pyrrolo[2,3-b]pyridine, 3-nitro-;3-Nitro-7-azaindole (3-Nitro-1H-pyrrolo[2,3-b]pyridine) | | CAS: | 23709-47-9 | | MF: | C7H5N3O2 | | MW: | 163.13 | | EINECS: | | | Product Categories: | | | Mol File: | 23709-47-9.mol |  |
| | 3-Nitro-7-azaindole Chemical Properties |
| Melting point | >300 °C | | Boiling point | 380.0±35.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.13±0.20(Predicted) | | form | powder | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H5N3O2/c11-10(12)6-4-9-7-5(6)2-1-3-8-7/h1-4H,(H,8,9) | | InChIKey | DTLVPICXPRRMOQ-UHFFFAOYSA-N | | SMILES | C12NC=C([N+]([O-])=O)C1=CC=CN=2 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 3-Nitro-7-azaindole Usage And Synthesis |
| Chemical Properties | Light yellow powder |
| | 3-Nitro-7-azaindole Preparation Products And Raw materials |
|