- Indometacine sodium
-
-
2026-09-15
- CAS:7681-54-1
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 5tons/month
|
| | INDOMETHACIN SODIUM Basic information |
| Product Name: | INDOMETHACIN SODIUM | | Synonyms: | 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1h-indole-3-aceticacisodiumsalt;1-(p-chlorobenzoyl)-5-methoxy-2-methyl-indole-3-aceticacisodiumsalt;osmosin;sodium1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1h-indole-3-acetate;sodiumindomethacin;1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetic acid sodium salt;IndoMetacine sodiuM;1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-Methoxy-2-Methyl-, sodiuM salt | | CAS: | 7681-54-1 | | MF: | C19H15ClNNaO4 | | MW: | 379.77 | | EINECS: | 231-670-4 | | Product Categories: | | | Mol File: | 7681-54-1.mol |  |
| | INDOMETHACIN SODIUM Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | Powder | | InChI | InChI=1S/C19H16ClNO4.Na/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12;/h3-9H,10H2,1-2H3,(H,22,23);/q;+1/p-1 | | InChIKey | JMHRGKDWGWORNU-UHFFFAOYSA-M | | SMILES | C12C=CC(OC)=CC=1C(=C(C)N2C(=O)C1C=CC(Cl)=CC=1)CC([O-])=O.[Na+] |
| | INDOMETHACIN SODIUM Usage And Synthesis |
| Description | Indomethacin sodium is a potent, orally active COX1/2 inhibitor with IC50 values of 18 nM and 26 nM for COX-1 and COX-2, respectively. Indomethacin sodium has anticancer activity and anti-infective activity. Indomethacin sodium can be used for cancer, inflammation and viral infection research. | | Uses | Anti-inflammatory. | | Brand name | Indocin (Ovation). | | in vivo | Indomethacin (Indometacin) sodium (0.01-10 mg/kg; p.o.; for 3 hours; male Sprague-Dawley rats) induces paw oedema and hyperalgesmeasurement dose-dependently reversed carrageenan-induced hyperalgesia[1].
Indomethacin (Indometacin) sodium (10 mg/mL; p.o.; daily, for 29 days; male C57BL/6J mice) inhibits tumor growth in vivo[2]. | Animal Model: | Male Sprague-Dawley rats[1] | | Dosage: | 0.01-10 mg/kg | | Administration: | Oral administration; for 3 hours | | Result: | Inhibited the carrageenan-induced rat paw oedema (ED50=2.0mg/kg) and hyperalgesia (ED50=1.5mg/kg) in a dose-dependent manner. |
| Animal Model: | Male C57BL/6J mice[2] | | Dosage: | 10 mg/mL | | Administration: | Oral administration; daily, for 29 days | | Result: | Delayed the onset of tumor growth and the initial growth rate of the footpad tumors. |
| | IC 50 | COX-1: IC50 = 0.1 μM (sheep); Cox-1: IC50 = 1.67 μM (human);
COX-2: IC50 = 6 μM (sheep); Cox-2: IC50 = 24.6 μM (human) |
| | INDOMETHACIN SODIUM Preparation Products And Raw materials |
|