| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3,6-Trifluoro-4-(trifluoromethyl)pyridine Basic information |
| | 2,3,6-Trifluoro-4-(trifluoromethyl)pyridine Chemical Properties |
| Boiling point | 102-104 °C | | density | 1.563 g/mL at 25 °C | | refractive index | n20/D 1.377 | | Fp | 98 °F | | pka | -10.89±0.18(Predicted) | | BRN | 6399655 | | InChI | 1S/C6HF6N/c7-3-1-2(6(10,11)12)4(8)5(9)13-3/h1H | | InChIKey | DODFHNWFNCGXOW-UHFFFAOYSA-N | | SMILES | Fc1cc(c(F)c(F)n1)C(F)(F)F |
| Hazard Codes | T,F,Xi | | Risk Statements | 10-25-36/37/38 | | Safety Statements | 26-36-45 | | RIDADR | UN 1992 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable/Irritant | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29333990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 2,3,6-Trifluoro-4-(trifluoromethyl)pyridine Usage And Synthesis |
| | 2,3,6-Trifluoro-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|