| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
cjbscvictory |
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | NEO-SAXITOXIN Basic information |
| Product Name: | NEO-SAXITOXIN | | Synonyms: | NEO-SAXITOXIN;NEO-STX;neo-saxitoxin from dinoflagellate;[(3aS,4R,10aS)-2-amino-5,10,10-trihydroxy-6-imino-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;(3aS,10aS)-2,6-Diamino-4α-[[(aminocarbonyl)oxy]methyl]-3aα,4,5,6,8,9-hexahydro-1H,10H-pyrrolo[1,2-c]purine-5,10,10-triol;1H,10H-Pyrrolo(1,2-C)purine-10,10-diol, 2-amino-4-((aminocarbonyl)oxy)methyl-3A,4,5,6,8,9-hexahydro-5-hydroxy-6-imino-, (3as-(3aalpha,4alpha,10ar*))-;Certified calibration solution for neosaxitoxin (0.5ml/Ampoule);1H,10H-Pyrrolo1,2-cpurine-10,10-diol, 2-amino-4-(aminocarbonyl)oxymethyl-3a,4,5,6,8,9-hexahydro-5-hydroxy-6-imino-, (3aS,4R,10aS)- | | CAS: | 64296-20-4 | | MF: | C10H17N7O5 | | MW: | 315.29 | | EINECS: | | | Product Categories: | | | Mol File: | 64296-20-4.mol |  |
| | NEO-SAXITOXIN Chemical Properties |
| Boiling point | 684.3±65.0 °C(Predicted) | | density | 2.32±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | form | solution | | pka | 6.52±0.60(Predicted) | | Major Application | food and beverages | | Cosmetics Ingredients Functions | ANTIOXIDANT
COLORANT
ASTRINGENT
ANTIPERSPIRANT
SKIN PROTECTING | | InChI | 1S/C10H17N7O5/c11-6-14-5-4(3-22-8(13)18)17(21)7(12)16-2-1-9(19,20)10(5,16)15-6/h4-5,12,19-21H,1-3H2,(H2,13,18)(H3,11,14,15)/t4-,5-,10-/m0/s1 | | InChIKey | PPEKGEBBBBNZKS-HGRQIUPRSA-N | | SMILES | [H][C@@]12[C@]3(NC(N2)=N)N(CCC3(O)O)C(N(O)[C@H]1COC(N)=O)=N | | EPA Substance Registry System | Neosaxitoxin (64296-20-4) |
| Hazard Codes | T+ | | Risk Statements | 26/27/28 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 3172 6.1/PG 1 | | WGK Germany | 3 | | Storage Class | 12 - Non Combustible Liquids |
| | NEO-SAXITOXIN Usage And Synthesis |
| Uses | cleaning products
cosmetics
food and beverages
personal care | | Definition | Toxin produced by red tide dinoflagellates. |
| | NEO-SAXITOXIN Preparation Products And Raw materials |
|