| Company Name: |
Hangzhou Sage Chemical Co., Ltd.
|
| Tel: |
+86057186818502 13588463833 |
| Email: |
info@sagechem.com |
| Products Intro: |
Product Name:2-Thiazolidineacetic acid, 4-carboxy-5,5-diMethyl-a-[(2-phenylacetyl)aMino]-
CAS:13057-98-2
Purity:98% Package:1g;5g;100g;Bulk
|
|
| | benzylpenicilloic acid Basic information |
| Product Name: | benzylpenicilloic acid | | Synonyms: | (2R)-5,5-Dimethyl-2α-[(R)-(phenylacetylamino)carboxymethyl]thiazolidine-4β-carboxylic acid;2-Thiazolidineacetic acid, 4-carboxy-5,5-diMethyl-a-[(2-phenylacetyl)aMino]-;4-Carboxy-5,5-dimethyl-α-[(2-phenylacetyl)amino]-2-thiazolidineacetic acid disodium salt;Benzylpenicillin Impurity 7;Benzylpenicillin Sodium Impurity Ⅲ:Impurity E)Benzyl Penicilloic Acid (Mixture of Diastereomers)(4S) -2-[carboxyl [(phenylacetyl) amino] methyl]-5,5-dimethylthiazolidine-4-carboxylic acid;Benzyl Penicilloic Acid (Mixture of Diastereomers);2-[2-hydroxy-2-oxo-1-[(2-phenylacetyl)amino]ethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid;Benzathine Benzylpenicillin EP Impurity E | | CAS: | 13057-98-2 | | MF: | C16H20N2O5S | | MW: | 352.41 | | EINECS: | | | Product Categories: | | | Mol File: | 13057-98-2.mol |  |
| | benzylpenicilloic acid Chemical Properties |
| Melting point | 112 °C | | Boiling point | 687.1±55.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | pKa 5.32±0.05(H2O t=25 c=0.01M)(Approximate) | | color | white | | InChI | 1S/C16H20N2O5S/c1-16(2)12(15(22)23)18-13(24-16)11(14(20)21)17-10(19)8-9-6-4-3-5-7-9/h3-7,11-13,18H,8H2,1-2H3,(H,17,19)(H,20,21)(H,22,23) | | InChIKey | HCYWNSXLUZRKJX-UHFFFAOYSA-N | | SMILES | S1C(NC(C1(C)C)C(=O)O)C(NC(=O)Cc2ccccc2)C(=O)O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | benzylpenicilloic acid Usage And Synthesis |
| Uses | Benzylpenicilloic Acid is a secondary metabolites in Penicillin G (61-33-6 an antibacterial, antimicrobial medication. |
| | benzylpenicilloic acid Preparation Products And Raw materials |
|