| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Sulfocalix[4]arene Basic information |
| Product Name: | 4-Sulfocalix[4]arene | | Synonyms: | Tetrasulfo(tetrahydroxy)calix[4]arene Hydrate;4-Sulfocalix[4]arene >=97.0% (HPLC);TETRAHYDROXYCALIX[4]ARENETETRASULFONIC ACID;TETRASULFO(TETRAHYDROXY)CALIX[4]ARENE;Calix[4]arene-4-sulfonic acid, 25,26,27,28-Tetrahydroxycalix[4]arene-5,11,17,23-tetrasulfonic acid;4-Sulfocalix[4]arene Hydrate;Tetrahydroxycalix[4]arenetetrasulfonic Acid
Tetrasulfo(tetrahydroxy)calix[4]arene;p-Sulfonatocalix[4]arene | | CAS: | 112269-92-8 | | MF: | C28H24O16S4 | | MW: | 744.74 | | EINECS: | | | Product Categories: | Calixarenes;Functional Materials;Macrocycles for Host-Guest Chemistry | | Mol File: | 112269-92-8.mol | ![4-Sulfocalix[4]arene Structure](CAS/GIF/112269-92-8.gif) |
| | 4-Sulfocalix[4]arene Chemical Properties |
| Melting point | >300℃ | | density | 1.786±0.06 g/cm3 (20 ºC 760 Torr) | | pka | -0.86±0.20(Predicted) | | form | powder to crystal | | color | White to Gray to Red | | InChIKey | JFYBCAFLVNKHHG-UHFFFAOYSA-N | | SMILES | Oc1c2Cc3cc(cc(Cc4cc(cc(Cc5cc(cc(Cc1cc(c2)S(O)(=O)=O)c5O)S(O)(=O)=O)c4O)S(O)(=O)=O)c3O)S(O)(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2908.99.1500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Sulfocalix[4]arene Usage And Synthesis |
| Uses | 4-Sulfocalix[4]arene (CAS# 112269-92-8) is a calixarene used in the preparation of resins for removal of toxic metals from canola oil, and is able to induce inhibition of the prototropic tautomerism in chrysazine, an anti-tumor compound. |
| | 4-Sulfocalix[4]arene Preparation Products And Raw materials |
|