- Dhurrin
-
- $98.00
-
2026-06-15
- CAS:499-20-7
- Purity: 99.15%
- Supply Ability: 10g
|
| | DHURRIN Basic information |
| Product Name: | DHURRIN | | Synonyms: | P-HYDROXYMANDELONITRILE-B-D-GLUCOSIDE;P-HYDROXYMANDELONITRILE-BETA-D-GLUCOSIDE;CYANOGLUCOSIDE;DHURRIN;4-HYDROXYMANDELONITRILE-BETA-D-GLUCOSIDE;DHURRIN(RG);(S)-α-(β-D-Glucopyranosyloxy)-4-hydroxybenzeneacetonitrile;(S)-4-Hydroxymandelonitrile beta-D-glucoside | | CAS: | 499-20-7 | | MF: | C14H17NO7 | | MW: | 311.29 | | EINECS: | 207-878-6 | | Product Categories: | Aromatic Nitriles | | Mol File: | 499-20-7.mol |  |
| | DHURRIN Chemical Properties |
| Melting point | 200°C (dec.) | | alpha | D20 -65° (alc) | | Boiling point | 586.7±50.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | room temp | | pka | 9.19±0.26(Predicted) | | form | powder or crystals | | color | white to light brown | | InChI | 1S/C14H17NO7/c15-5-9(7-1-3-8(17)4-2-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-4,9-14,16-20H,6H2/t9-,10-,11-,12+,13-,14-/m1/s1 | | InChIKey | NVLTYOJHPBMILU-YOVYLDAJSA-N | | SMILES | OC[C@H]1O[C@@H](O[C@H](C#N)c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O || OC[C@H]1O[C@@H](O[C@H](C#N)c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O | | LogP | -1.650 (est) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-45 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | DHURRIN Usage And Synthesis |
| Uses | Dhurrin is a cyanogenic glucoside produced by sorghum and is considered a natural defense compound producing hydrogen cyanide to deter animal herbivores. | | Definition | ChEBI: (S)-4-hydroxymandelonitrile beta-D-glucoside is a beta-D-glucoside consisting of (S)-prunasin carrying a hydroxy substituent at position 4 on the phenyl ring. It is a beta-D-glucoside, a nitrile, a cyanogenic glycoside and a monosaccharide derivative. It is functionally related to a (S)-prunasin. |
| | DHURRIN Preparation Products And Raw materials |
|