|
|
| | Ar-curcumene Basic information |
| Product Name: | Ar-curcumene | | Synonyms: | (+)-1-[(S)-1,5-Dimethyl-4-hexenyl]-4-methylbenzene;1-[(1S)-1,5-Dimethyl-4-hexenyl]-4-methylbenzene;1-[(S)-1,5-Dimethyl-4-hexenyl]-4-methylbenzene;Benzene, 1-[(1S)-1,5-dimethyl-4-hexen-1-yl]-4-methyl-;(+)-alpha-Curcumene;d-ar-Curcumene;Ar-curcumene | | CAS: | 4176-06-1 | | MF: | C15H22 | | MW: | 202.34 | | EINECS: | | | Product Categories: | | | Mol File: | 4176-06-1.mol |  |
| | Ar-curcumene Chemical Properties |
| Boiling point | 128-130 °C(Press: 7 Torr) | | density | 0.8633 g/cm3(Temp: 30 °C) | | solubility | Chloroform (Slightly), Hexane (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Volatile | | InChI | InChI=1S/C15H22/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-11,14H,5,7H2,1-4H3/t14-/m0/s1 | | InChIKey | VMYXUZSZMNBRCN-AWEZNQCLSA-N | | SMILES | C1([C@@H](C)CC/C=C(/C)\C)=CC=C(C)C=C1 | | LogP | 6.018 (est) |
| | Ar-curcumene Usage And Synthesis |
| Uses | (S)-ar-Curcumene is used in the study and the characterization of the antioxidant and antimicrobial compounds of cinnamon and ginger essential oils, also in the phytochemical and biological studies of the flower and fruits of Pongamia pinnata. |
| | Ar-curcumene Preparation Products And Raw materials |
|