|
|
| Product Name: | vx993 | | Synonyms: | vx993;2-Furancarboxamide, 3-(3,4-difluoro-2-methoxyphenyl)-N-[6-[(1R)-1,2-dihydroxyethyl]-3-pyridinyl]tetrahydro-4,5-dimethyl-5-(trifluoromethyl)-, (2R,3S,4S,5R)- | | CAS: | 2877755-11-6 | | MF: | C22H23F5N2O5 | | MW: | 490.42 | | EINECS: | | | Product Categories: | | | Mol File: | 2877755-11-6.mol |  |
| | vx993 Chemical Properties |
| Boiling point | 605.706±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.408±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 12.181±0.70(predicted) | | form | Solid | | color | White to off-white | | InChIKey | HXXNLIYFNQKZHX-PEHJGKTGSA-N | | SMILES | C([C@@H]1O[C@@]([C@H]([C@H]1C1C=CC(=C(C=1OC)F)F)C)(C)C(F)(F)F)(=O)NC1=CN=C(C=C1)[C@@H](O)CO |
| | vx993 Usage And Synthesis |
| Uses | Sodium Channel inhibitor 6 (compound I) is a sodium channel inhibitor that can be used in the study of neuropathic pain[1]. | | References | [1] Cristian Harrison, et al. Process for the synthesis of substituted tetrahydrofuran modulators of sodium channels. WO2024123815A1. 2023-12-06 |
| | vx993 Preparation Products And Raw materials |
|