7-Amino-3-(2-furoylthiomethyl)-3-cephem-4-carboxylic acid manufacturers
- 7-ACF
-
-
2026-03-27
- CAS:80370-59-8
- Min. Order: 1KG
- Purity: 98.5% HPLC
- Supply Ability: 5 ton
|
| | 7-Amino-3-(2-furoylthiomethyl)-3-cephem-4-carboxylic acid Basic information |
| | 7-Amino-3-(2-furoylthiomethyl)-3-cephem-4-carboxylic acid Chemical Properties |
| Melting point | >200oC (dec.) | | storage temp. | Refrigerator | | solubility | DMSO (Sparingly) | | form | Solid | | color | Pale Beige | | InChI | InChI=1S/C13H12N2O5S2/c14-8-10(16)15-9(12(17)18)6(4-21-11(8)15)5-22-13(19)7-2-1-3-20-7/h1-3,8,11H,4-5,14H2,(H,17,18)/t8-,11-/m1/s1 | | InChIKey | ZMPDMYFTSINIIZ-LDYMZIIASA-N | | SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(CSC(C1=CC=CO1)=O)=C2C(O)=O |
| | 7-Amino-3-(2-furoylthiomethyl)-3-cephem-4-carboxylic acid Usage And Synthesis |
| Description | 7-Amino-3-(2-furoylthiomethyl)-3-cephem-4-carboxylic acid(Desthiazoximic Acid Ceftiofur) is a fine chemical that is a versatile component of complex compounds. It is used in the development of new drugs and in the production of intermediates, reagents and speciality chemicals. Desthiazoximic Acid Ceftiofur has been shown to be used in the synthesis of high quality, useful intermediate compounds and scaffolds for organic synthesis. | | Chemical Properties | Light Brown Solid | | Uses | Ceftiofur intermediate. |
| | 7-Amino-3-(2-furoylthiomethyl)-3-cephem-4-carboxylic acid Preparation Products And Raw materials |
|