5-BENZYLOXYINDOLE-3-ACETIC ACID manufacturers
|
| | 5-BENZYLOXYINDOLE-3-ACETIC ACID Basic information |
| | 5-BENZYLOXYINDOLE-3-ACETIC ACID Chemical Properties |
| Melting point | 147-149 °C(Solv: ethanol, 50% (64-17-5)) | | Boiling point | 533.2±40.0 °C(Predicted) | | density | 1.314±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | crystalline | | pka | 4.51±0.30(Predicted) | | color | off-white to tan | | InChI | 1S/C17H15NO3/c19-17(20)8-13-10-18-16-7-6-14(9-15(13)16)21-11-12-4-2-1-3-5-12/h1-7,9-10,18H,8,11H2,(H,19,20) | | InChIKey | GKIOPUYLJUOZHJ-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1c[nH]c2ccc(OCc3ccccc3)cc12 | | CAS DataBase Reference | 4382-53-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 5-BENZYLOXYINDOLE-3-ACETIC ACID Usage And Synthesis |
| Uses | Reactant for preparation of:
- Inhibitors of Gli1-mediated transcription as potential anticancer agents
- Synthetic analogs of spider toxins
| | Uses | 5-Benzyloxyindole-3-acetic Acid can be used for biological study for molecular recognition of indole derivatives by polymers imprinted with indole-3-acetic acid. | | Synthesis Reference(s) | Tetrahedron Letters, 35, p. 3013, 1994 DOI: 10.1016/S0040-4039(00)76815-8 |
| | 5-BENZYLOXYINDOLE-3-ACETIC ACID Preparation Products And Raw materials |
|