| Company Name: |
Alchem Pharmtech,Inc. |
| Tel: |
8485655694 |
| Email: |
sales@alchempharmtech.com |
| Products Intro: |
Product Name:1,1,7,7-Tetramethyl-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline CAS:325722-28-9 Purity:97+% Package:1g;10g;100g;;1kg Remarks:Z-55056
|
|
|
|
|
|
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE Basic information |
| Product Name: | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE | | Synonyms: | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE;1,1,7,7-Tetramethyl-1,2,3,5,6,7-hexahydro-pyrido[3,2,1-ij]quinoline;PubChem ID: 11390577;1H,5H-Benzo[ij]quinolizine, 2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-;1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE ISO 9001:2015 REACH | | CAS: | 325722-28-9 | | MF: | C16H23N | | MW: | 229.36 | | EINECS: | | | Product Categories: | Quinoline&Isoquinoline | | Mol File: | 325722-28-9.mol | ![1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE Structure](CAS/GIF/325722-28-9.gif) |
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE Chemical Properties |
| Boiling point | 303.0±32.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 6.68±0.60(Predicted) | | InChI | InChI=1S/C16H23N/c1-15(2)8-10-17-11-9-16(3,4)13-7-5-6-12(15)14(13)17/h5-7H,8-11H2,1-4H3 | | InChIKey | MZKXTXKVGSAPEG-UHFFFAOYSA-N | | SMILES | C12=CC=CC3=C1N(CCC3(C)C)CCC2(C)C |
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE Usage And Synthesis |
| Chemical Properties | White Crystals |
| | 1,1,7,7-TETRAMETHYL-2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ] QUINOLINE Preparation Products And Raw materials |
|