| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tetramethyljulolidine Basic information |
| Product Name: | Tetramethyljulolidine | | Synonyms: | tetramethyljulolidine;1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1h,5h-benzo[ij]quinolizin-8-ol;8-HYDROXY-1,1,7,7-TETRAMETHYLJULOLIDINE-CARBOXALDEHYDE;1,1,7,7-Tetramethyl-8-hydroxyjulolidine;1,1,7,7-TetraMethyl-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinolin-8-ol;1H,5H-Benzo[ij]quinolizin-8-ol,2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-;Tetramethylgulonidine;Tetramethyljulolidine ISO 9001：2015 REACH | | CAS: | 115704-83-1 | | MF: | C16H23NO | | MW: | 245.36 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 115704-83-1.mol |  |
| | Tetramethyljulolidine Chemical Properties |
| Boiling point | 348.6±42.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 11.29±0.60(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C16H23NO/c1-15(2)7-9-17-10-8-16(3,4)13-12(18)6-5-11(15)14(13)17/h5-6,18H,7-10H2,1-4H3 | | InChIKey | RBFKOHMQYNQBAR-UHFFFAOYSA-N | | SMILES | C12=CC=C(O)C3=C1N(CCC3(C)C)CCC2(C)C |
| | Tetramethyljulolidine Usage And Synthesis |
| Uses | 1,1,7,7-Tetramethyl-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinolin-8-ol is a useful reactant for the preparation of aminobenzopyranoxanthenes with nitrogen containing fused rings. |
| | Tetramethyljulolidine Preparation Products And Raw materials |
|