|
|
| | 2-Chloro-3-methylthiophene Basic information |
| | 2-Chloro-3-methylthiophene Chemical Properties |
| Melting point | 153-157 °C | | Boiling point | 147-149 °C (lit.) | | density | 1.211 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5400(lit.) | | Fp | 115 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C5H5ClS/c1-4-2-3-7-5(4)6/h2-3H,1H3 | | InChIKey | KQFADYXPELMVHE-UHFFFAOYSA-N | | SMILES | C1(Cl)SC=CC=1C | | CAS DataBase Reference | 14345-97-2(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 10-22-41-36/37/38 | | Safety Statements | 16-26-39-37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 |
| | 2-Chloro-3-methylthiophene Usage And Synthesis |
| Chemical Properties | clear yellow to yellow-brown liquid |
| | 2-Chloro-3-methylthiophene Preparation Products And Raw materials |
|