| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-Ledene Basic information |
| Product Name: | (+)-Ledene | | Synonyms: | 1,1,4,7-Tetramethyl-1a,2,3,5,6,7,7a,7b-octahydro-1H-cyclopropa[e]azulene;1H-Cycloprop[e]azulene, 1a,2,3,5,6,7,7a,7b-octahydro-1,1,4,7-tetramethyl-, [1aR-(1aalpha,7alpha,7abeta,7balpha)]-;Varidiflorene;Viridflorene;(+)-Ledene >=95.0% (sum of enantiomers, GC);[1aR-(1aalpha,7alpha,7abeta,7balpha)]-1a,2,3,5,6,7,7a,7b-octahydro-1,1,4,7-tetramethyl-1H-cycloprop[e]azulene;(1S,2R,3R,11R)-3,3,7,11-TETRAMETHYL-TRICYCLO[6.3.0.0(2.4)]UNDEC-7-ENE;(+)-LEDENE 95+% MIXTURE OF ISOMERS | | CAS: | 21747-46-6 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 244-565-3 | | Product Categories: | | | Mol File: | 21747-46-6.mol |  |
| | (+)-Ledene Chemical Properties |
| Melting point | 269°C | | Boiling point | 268-270 °C (lit.) | | density | 0.927 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.504 | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Ethanol (Slightly) | | form | Oil | | color | Colourless | | Optical Rotation | [α]20/D +68±2°, c = 10% in ethanol | | BRN | 2554786 | | InChI | 1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10,12-14H,5-8H2,1-4H3/t10-,12-,13-,14-/m1/s1 | | InChIKey | WGTRJVCFDUCKCM-FMKGYKFTSA-N | | SMILES | C[C@@H]1CCC2=C(C)CC[C@@H]3[C@H]([C@H]12)C3(C)C | | LogP | 6.447 (est) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | (+)-Ledene Usage And Synthesis |
| Description | (+)-Ledene, also called leden or viridiflorene, is an organic compound that belongs to the group of 5, 10-cycloaromadendrane sesquiterpenoids. These compounds are derived from the aromadendrane skeleton through a cyclization reaction between carbon atoms 5 and 10. (+)-Ledene is mainly found in saliva and is considered to have low solubility in water and a relatively neutral nature. In cellular environments, (+)-ledene is predominantly present in the cell membrane (predicted based on logP) and cytoplasm. | | Uses | (+)-Ledene is an essential oil that is synthesized by viridiflorene synthase. It has been studied as an antioxidant, antimicrobial, antibiofilm and to treat various cancers. | | Definition | ChEBI: Viridiflorene is a carbotricyclic sesquiterpene obtained from several natural sources, including Australian Tea Tree oil (Melaleuca alternifolia.) It is a sesquiterpene and a carbotricyclic compound. | | General Description | (+)-Ledene is a naturally occurring sesquiterpene that can be prepared from (+)-aromadendrene via isomerization. | | References | [1] DUC N. TRAN Prof.Dr. N C. Biomimetic Synthesis of (+)-Ledene, (+)-Viridiflorol, ()-Palustrol, (+)-Spathulenol, and Psiguadial A, C, and D via the Platform Terpene (+)-Bicyclogermacrene[J]. Chemistry - A European Journal, 2014. DOI:10.1002/chem.201403082.
[2] S. L. GWALTNEY K. J S S T Sakata. Bridged to Fused Ring Interchange. Methodology for the Construction of Fused Cycloheptanes and Cyclooctanes. Total Syntheses of Ledol, Ledene, and Compressanolide[J]. The Journal of Organic Chemistry, 1996. DOI:10.1021/jo961005a. |
| | (+)-Ledene Preparation Products And Raw materials |
|