| Company Name: |
HASWELL Gold |
| Tel: |
13951186658 |
| Email: |
Haswellvip@gmail.com |
|
| | N-HEPTADECANOPHENONE Basic information |
| Product Name: | N-HEPTADECANOPHENONE | | Synonyms: | N-HEPTADECANOPHENONE;1-Phenylheptadecan-1-one;Heptadecanophenone;N-HEPTADECANOPHENONE 98+%;8-(1-ethoxy-2-hydroxy-3-methylbut-3-enyl)-7-methoxy-1-benzopyran-2-one;Heptadecanophenone>1-Heptadecanone, 1-phenyl- | | CAS: | 128189-46-8 | | MF: | C23H38O | | MW: | 330.55 | | EINECS: | | | Product Categories: | | | Mol File: | 128189-46-8.mol |  |
| | N-HEPTADECANOPHENONE Chemical Properties |
| Melting point | 57 °C | | Boiling point | 431.8±14.0 °C(Predicted) | | density | 0.896±0.06 g/cm3(Predicted) | | form | powder to crystaline | | color | White to Almost white | | InChI | InChI=1S/C23H38O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-21-23(24)22-19-16-15-17-20-22/h15-17,19-20H,2-14,18,21H2,1H3 | | InChIKey | VUXIOSYYRVXOOT-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCCCCCCCCCCCCCCC |
| | N-HEPTADECANOPHENONE Usage And Synthesis |
| | N-HEPTADECANOPHENONE Preparation Products And Raw materials |
|