- 3-Aminobutanoic acid
-
- $29.00 / 200mg
-
2026-03-13
- CAS:541-48-0
- Min. Order:
- Purity: 98.48%
- Supply Ability: 10g
- DL-3-AMINOBUTYRIC ACID
-
- $0.00 / 25KG
-
2025-12-01
- CAS:541-48-0
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | DL-3-AMINOBUTYRIC ACID Basic information |
| Product Name: | DL-3-AMINOBUTYRIC ACID | | Synonyms: | 3-amino-butanoicaci;AMINOBUTYRIC ACID, 3-;3-AMINOBUTANOIC ACID;3-AMINOBUTYLIC ACID;3-AMINOBUTYRIC ACID;H-DL-ABU(3)-OH;H-DL-ABU(BETA)-OH;H-DL-BETA-ABU-OH | | CAS: | 541-48-0 | | MF: | C4H9NO2 | | MW: | 103.12 | | EINECS: | 208-783-2 | | Product Categories: | Amino Acids | | Mol File: | 541-48-0.mol |  |
| | DL-3-AMINOBUTYRIC ACID Chemical Properties |
| Melting point | 189 °C (dec.)(lit.) | | Boiling point | 223.6±23.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Water | | pka | 3.67±0.12(Predicted) | | form | Solid | | color | Off-White | | Water Solubility | almost transparency | | Merck | 14,429 | | BRN | 1720563 | | InChI | InChI=1S/C4H9NO2/c1-3(5)2-4(6)7/h3H,2,5H2,1H3,(H,6,7) | | InChIKey | OQEBBZSWEGYTPG-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(N)C | | CAS DataBase Reference | 541-48-0(CAS DataBase Reference) | | EPA Substance Registry System | Butanoic acid, 3-amino- (541-48-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | EK7713333 | | TSCA | TSCA listed | | HS Code | 2922.49.4950 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | DL-3-AMINOBUTYRIC ACID Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 3-Aminobutyric Acid is one of the three positional isomer of the the chemical compound butryric acid. 3-Aminobutyric Acid is a nonprotein amino acid. 3-Aminobutyric Acid has been shown to be a plant d
efense primer that suppresses growth of some insect herbivores when applied as a root drench. | | Uses | 3-Aminobutanoic acid can be used as a reactant to synthesize:
- -aryl amino butanoic acids by Ullmann type aryl amination reaction with aryl halides.
- 3-amino butanoic acid methyl ester, which is used as a chemical intermediate to prepare substituted piperidinone via an ester-imine derivative of aminobutanoic acid.
| | Definition | ChEBI: A beta-amino acid that is butyric acid which is substituted by an amino group at position 3. | | Hazard | Highly toxic. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | DL-3-AMINOBUTYRIC ACID Preparation Products And Raw materials |
|