(-)-3-Dehydroshikimic acid manufacturers
|
| | (-)-3-Dehydroshikimic acid Basic information |
| Product Name: | (-)-3-Dehydroshikimic acid | | Synonyms: | 5-DEHYDROSHIKIMIC ACID;4,5-DIHYDROXY-3-OXO TRANS;(4(S)-TRANS)-4,5-DIHYDROXY-3-OXO-1-CYCLOHEXENE-1-CARBOXYLIC ACID;DHS, 5-Dehydroshikimic Acid, 1-Cyclohexene-1-carboxylic Acid, 4,5-Dihydroxy-3-oxo trans;(4S)-4β,5α-Dihydroxy-3-oxo-1-cyclohexene-1-carboxylic acid;(4S,5R)-3-Oxo-4,5-dihydroxycyclohexa-1-ene-1-carboxylic acid;3-Oxo-4β,5α-dihydroxy-1-cyclohexene-1-carboxylic acid;4,5-dihydroxy-3-keto-cyclohexene-1-carboxylic acid | | CAS: | 2922-42-1 | | MF: | C7H8O5 | | MW: | 172.14 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities;Metabolites | | Mol File: | 2922-42-1.mol |  |
| | (-)-3-Dehydroshikimic acid Chemical Properties |
| Melting point | 150-152 °C | | Boiling point | 405.1±45.0 °C(Predicted) | | density | 1.713±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 3.03±0.60(Predicted) | | color | Off-White to Beige | | Optical Rotation | [α]/D -59.0±3.0°, c = 1 in ethanol | | Stability: | Temperature Sensitive | | InChI | 1S/C7H8O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,5-6,9-10H,2H2,(H,11,12)/t5-,6-/m1/s1 | | InChIKey | SLWWJZMPHJJOPH-PHDIDXHHSA-N | | SMILES | O[C@@H]1CC(=CC(=O)[C@H]1O)C(O)=O || O[C@@H]1CC(=CC(=O)[C@H]1O)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | (-)-3-Dehydroshikimic acid Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | A metabolite of Shikimic Acid | | Uses | 3-Dehydroshikimic acid is a biochemical intermediate from D-glucose in the synthesis of pro-catechuic acid. 3-Dehydroshikimic acid has been used in a study to describe the synthesis of catechuic acid (1) and ethyl 2,4,5-trihydroxybenzoate (2) from D-glucose-derived β-ketoester. 3-Dehydroshikimic acid has also been used in studies to evaluate the shikimate biosynthetic pathway, in order to develop nontoxic antimicrobial agents, herbicides, and antiparasite drugs. | | Definition | ChEBI: A 4-oxo monocarboxylic acid that is shikimic acid in which the allylic hydroxy group has been oxidised to the corresponding keto group. | | Biochem/physiol Actions | Metabolite of the shikimate pathway with a chromophore suitable for continuous spectrophotometric assay. Precursor of aromatic metabolites in microorganisms. |
| | (-)-3-Dehydroshikimic acid Preparation Products And Raw materials |
|