| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Ethyl 2-nitrobutyrate manufacturers
|
| | Ethyl 2-nitrobutyrate Basic information |
| | Ethyl 2-nitrobutyrate Chemical Properties |
| Boiling point | 82-83 °C8 mm Hg(lit.) | | density | 1.096 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.423(lit.) | | Fp | 186 °F | | pka | 5.98±0.36(Predicted) | | InChI | 1S/C6H11NO4/c1-3-5(7(9)10)6(8)11-4-2/h5H,3-4H2,1-2H3 | | InChIKey | IENPWWUIYXMCJY-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(CC)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Ethyl 2-nitrobutyrate Usage And Synthesis |
| Uses | Ethyl 2-nitrobutyrate is a 2-nitroethyl ester of butyric acid. Synthesis of ethyl α-nitrobutyrate from ethyl α-bromobutyrate has been reported. | | General Description | Ethyl 2-nitrobutyrate is a 2-nitroethyl ester of butyric acid. Synthesis of ethyl α-nitrobutyrate from ethyl α-bromobutyrate has been reported. |
| | Ethyl 2-nitrobutyrate Preparation Products And Raw materials |
|