|
|
| | Ac-Thr(Ac)-OH Basic information |
| Product Name: | Ac-Thr(Ac)-OH | | Synonyms: | AC-THREONINE(AC)-OH;ACETYL-O-ACETYL-L-THREONINE;N-acetyl-O-carboxy-L-threonine;L-Threonine, N-acetyl-, acetate (ester) (9CI);n,o-Diacetyl-l-threonine;Ac-Thr(Ac)-OH | | CAS: | 137197-06-9 | | MF: | C8H13NO5 | | MW: | 203.19 | | EINECS: | | | Product Categories: | | | Mol File: | 137197-06-9.mol |  |
| | Ac-Thr(Ac)-OH Chemical Properties |
| Boiling point | 444.7±40.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 3.21±0.10(Predicted) | | InChI | InChI=1S/C8H13NO5/c1-4(14-6(3)11)7(8(12)13)9-5(2)10/h4,7H,1-3H3,(H,9,10)(H,12,13)/t4-,7+/m1/s1 | | InChIKey | FHYSLJXFHVWFLV-FBCQKBJTSA-N | | SMILES | C(O)(=O)[C@H]([C@H](OC(=O)C)C)NC(C)=O |
| | Ac-Thr(Ac)-OH Usage And Synthesis |
| | Ac-Thr(Ac)-OH Preparation Products And Raw materials |
|