O-Acetyl-L-serine manufacturers
- O-AC-L-Ser-OH
-
-
2026-09-30
- CAS:5147-00-2
- Min. Order: 1kg
- Purity: 98+
- Supply Ability: 1T
|
| | O-Acetyl-L-serine Basic information |
| Product Name: | O-Acetyl-L-serine | | Synonyms: | (2S)-2-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methylamino]-4-methylsulfanyl-butanoic acid;C00979;L-Serine, O-acetyl-;(2S)-3-(acetyloxy)-2-aminopropanoic acid;O-Acetylserine, >98%;(S)-3-Acetoxy-2-aminopropanoic acid;O-ACETYL-L-SERINE USP/EP/BP;O Acetylserine,O-Acetylserine,Endogenous Metabolite,inhibit,OAcetylserine,Inhibitor | | CAS: | 5147-00-2 | | MF: | C5H9NO4 | | MW: | 147.13 | | EINECS: | | | Product Categories: | | | Mol File: | 5147-00-2.mol |  |
| | O-Acetyl-L-serine Chemical Properties |
| Melting point | 151.5-151.8 °C | | Boiling point | 297.7±35.0 °C(Predicted) | | density | 1.299±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Slightly, Sonicated), Methanol (Very Slightly), Water (Slightly) | | form | Solid | | pka | 1.98±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C5H9NO4/c1-3(7)10-2-4(6)5(8)9/h4H,2,6H2,1H3,(H,8,9)/t4-/m0/s1 | | InChIKey | VZXPDPZARILFQX-BYPYZUCNSA-N | | SMILES | C(O)(=O)[C@H](COC(C)=O)N |
| | O-Acetyl-L-serine Usage And Synthesis |
| Uses | O-Acetyl-L-serine is used in methods for identifying compounds for inhibiting COX-1, COX-2 and lipoxygenase for selective elimination of senescent cells. | | Definition | ChEBI: An acetyl-L-serine where the acetyl group is attached to the side-chain oxygen. It is an intermediate in the biosynthesis of the amino acid cysteine in bacteria. | | IC 50 | Human Endogenous Metabolite |
| | O-Acetyl-L-serine Preparation Products And Raw materials |
|