| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Val-Ala p-nitroanilide acetate salt Basic information |
| | Val-Ala p-nitroanilide acetate salt Chemical Properties |
| storage temp. | 2-8°C | | solubility | ethanol: 50mg/mL | | form | powder | | InChI | 1S/C14H20N4O4.C2H4O2/c1-8(2)12(15)14(20)16-9(3)13(19)17-10-4-6-11(7-5-10)18(21)22;1-2(3)4/h4-9,12H,15H2,1-3H3,(H,16,20)(H,17,19);1H3,(H,3,4)/t9-,12-;/m0./s1 | | InChIKey | FKCPQOSQHMADPR-CSDGMEMJSA-N | | SMILES | CC(O)=O.CC(C)[C@H](N)C(=O)N[C@@H](C)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Val-Ala p-nitroanilide acetate salt Usage And Synthesis |
| Chemical Properties | Light yellow powder |
| | Val-Ala p-nitroanilide acetate salt Preparation Products And Raw materials |
|