| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (+)-1,4-DI-O-BENZYL-D-THREITOL Basic information |
| Product Name: | (+)-1,4-DI-O-BENZYL-D-THREITOL | | Synonyms: | 1,4-DI-O-BENZYL-D-THREITOL;(2R,3R)-(+)-1,4-DIBENZYLOXY-2,3-BUTANEDIOL;2,3-BUTANEDIOL, 1,4-BIS(PHENYLMETHOXY)-, (2R,3R)-;Dibenzylthreitol;(+)-1,4-Di-O-benzyl-D-threito;1,4-dibenzyloxy-2,3-butanediol;(+)-(2R,3R)-1,4-Bis(benzyloxy)-2,3-butanediol, (+)-1,4-Di-O-benzyl-D-threitol, 1,4-Di-O-benzyl-D-threitol;REF DUPL: (+)-1,4-Di-O-benzyl-D-threitol | | CAS: | 91604-41-0 | | MF: | C18H22O4 | | MW: | 302.37 | | EINECS: | | | Product Categories: | chiral;Asymmetric Synthesis;Biochemistry;Chiral Building Blocks;Simple Alcohols (Chiral);Sugar Alcohols;Sugars;Synthetic Organic Chemistry | | Mol File: | 91604-41-0.mol |  |
| | (+)-1,4-DI-O-BENZYL-D-THREITOL Chemical Properties |
| Melting point | 55-57 °C (lit.) | | Boiling point | 484.4±45.0 °C(Predicted) | | density | 1.174±0.06 g/cm3(Predicted) | | refractive index | 6.3 ° (C=5, CHCl3) | | solubility | almost transparency in Chloroform | | pka | 13.24±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D +6°, c = 5 in chloroform | | BRN | 3557415 | | InChI | 1S/C18H22O4/c19-17(13-21-11-15-7-3-1-4-8-15)18(20)14-22-12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18-/m1/s1 | | InChIKey | YAVAVQDYJARRAU-QZTJIDSGSA-N | | SMILES | O[C@H](COCc1ccccc1)[C@H](O)COCc2ccccc2 | | CAS DataBase Reference | 91604-41-0(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2909.49.1500 | | Storage Class | 11 - Combustible Solids |
| | (+)-1,4-DI-O-BENZYL-D-THREITOL Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde |
| | (+)-1,4-DI-O-BENZYL-D-THREITOL Preparation Products And Raw materials |
|