|
|
| | 4,5-Dichloro-1,2-benzenediamine Basic information |
| Product Name: | 4,5-Dichloro-1,2-benzenediamine | | Synonyms: | 1,2-Dichloro-4,5-diaminobenzene;4,5-Dichloro-1,2-benzenediamine;4,5-Dichloro-o-phenylendiamine;1,2-Diamino-4,5-dichlorobenzene, 4,5-Dichloro-1,2-phenylenediamine;4,5-Dichloro-o-phenylenediamine,98%;4,5-Dichloro-1,2-phenylenediamine ,97%;4,5-Dichlorobenzene-1,2-diamine 98%;4,5-Dichloro-phenylenediaMine | | CAS: | 5348-42-5 | | MF: | C6H6Cl2N2 | | MW: | 177.03 | | EINECS: | 226-305-0 | | Product Categories: | Building Blocks;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;Polyamines;Aromatics;Miscellaneous Reagents;Amines;blocks;Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 5348-42-5.mol |  |
| | 4,5-Dichloro-1,2-benzenediamine Chemical Properties |
| Melting point | 158-164 °C(lit.) | | Boiling point | 291.88°C (rough estimate) | | density | 1.4668 (rough estimate) | | refractive index | 1.6400 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | form | Crystalline Powder | | pka | 2.77±0.10(Predicted) | | color | Red-brown to brown | | Water Solubility | Soluble in methanol and Dimethyl sulfoxide. Insoluble in water. | | BRN | 1072811 | | InChI | InChI=1S/C6H6Cl2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2 | | InChIKey | IWFHBRFJOHTIPU-UHFFFAOYSA-N | | SMILES | C1(N)=CC(Cl)=C(Cl)C=C1N | | CAS DataBase Reference | 5348-42-5(CAS DataBase Reference) | | NIST Chemistry Reference | 4,5-Dichloro-ortho-phenylenediamine(5348-42-5) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 26-36-45-36/37 | | RIDADR | 2811 | | WGK Germany | 3 | | F | 10 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29215900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4,5-Dichloro-1,2-benzenediamine Usage And Synthesis |
| Chemical Properties | red-brown to brown crystalline powder | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Purification Methods | Reflux the amine with activated charcoal in CH2Cl2, followed by recrystallisation from Et2O/pet ether or pet ether [Koolar & Kochi J Org Chem 52 4545 1987]. Alternatively, recrystallise the diamine from hexane, *C6H6, pet ether or H2O (Na2SO4) and sublime it at 150o/15mm. [Beilstein 13 IV 72.] |
| | 4,5-Dichloro-1,2-benzenediamine Preparation Products And Raw materials |
|