L-beta-Homoisoleucine hydrochloride manufacturers
|
| | L-beta-Homoisoleucine hydrochloride Basic information |
| | L-beta-Homoisoleucine hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | color | white | | Major Application | peptide synthesis | | InChI | 1S/C7H15NO2.ClH/c1-3-5(2)6(8)4-7(9)10;/h5-6H,3-4,8H2,1-2H3,(H,9,10);1H/t5-,6+;/m0./s1 | | InChIKey | RWKVKXFASXUCRV-RIHPBJNCSA-N | | SMILES | Cl.CC[C@H](C)[C@H](N)CC(O)=O | | CAS DataBase Reference | 219310-10-8(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-beta-Homoisoleucine hydrochloride Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | L-beta-Homoisoleucine Hydrochloride | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-beta-Homoisoleucine hydrochloride Preparation Products And Raw materials |
|