|
|
| | 3,5-DI-TERT-BUTYLBENZYL ALCOHOL Basic information |
| Product Name: | 3,5-DI-TERT-BUTYLBENZYL ALCOHOL | | Synonyms: | (3,5-di-tert-butylphenyl)methanol;3,5-Di-tert-butylbenzyl Alcohol;(3,5-Di-tert-butylphenyl);3,5-DI-TERT-BUTYLBENZYL ALCOHOL;RARECHEM AL BD 0560;3,5-Di-tert-butylbenzylAlcohol>Benzenemethanol, 3,5-bis(1,1-dimethylethyl)-;(3,5-di-tert-butylphenyl)methanolato | | CAS: | 77387-57-6 | | MF: | C15H24O | | MW: | 220.35 | | EINECS: | | | Product Categories: | | | Mol File: | 77387-57-6.mol |  |
| | 3,5-DI-TERT-BUTYLBENZYL ALCOHOL Chemical Properties |
| Melting point | 62 °C | | Boiling point | 251.1±8.0 °C(Predicted) | | density | 0.931±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 14+-.0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C15H24O/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-9,16H,10H2,1-6H3 | | InChIKey | VHYHRNYPVNFGNR-UHFFFAOYSA-N | | SMILES | C1(CO)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| | 3,5-DI-TERT-BUTYLBENZYL ALCOHOL Usage And Synthesis |
| | 3,5-DI-TERT-BUTYLBENZYL ALCOHOL Preparation Products And Raw materials |
|