| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
2'-O-Methyl-5-methyl-U CEP manufacturers
|
| | 2'-O-Methyl-5-methyl-U CEP Basic information |
| Product Name: | 2'-O-Methyl-5-methyl-U CEP | | Synonyms: | 5'-O-DMT-2'-O-methyl-5-methyluridine 3'-CE phosphoramidite;5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-5-methyl-2'-O-methyluridine 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite];2'-O-Methyl-5-Methyl-U CE phosphoramidite;(2R,3R,4R,5R)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)-5-(5-methyl-2,4-dioxo-3,4-dihyd ropyrimidin-1(2H)-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite;Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-5-methyl-2'-O-methyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI);5'-O-DMT-5-Methy-2'-O-methyluridine 3'-CE phosphoramidite;5’-O-DMTr-2’-O-methyl-5-methyluridine 3’-CED phosphoramidite;DMT-2'-OME-dU(Bz)-CE-Phosphoramidite | | CAS: | 153631-20-0 | | MF: | C41H51N4O9P | | MW: | 774.84 | | EINECS: | | | Product Categories: | | | Mol File: | 153631-20-0.mol |  |
| | 2'-O-Methyl-5-methyl-U CEP Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | pka | 9.55±0.10(Predicted) | | form | Solid | | color | Off-white to yellow | | InChIKey | GMJRPRHRYILEOK-LTRUQRBFNA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C=C(C)C(=O)NC2=O)[C@H](OC)[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |&1:25,27,37,40,r| |
| | 2'-O-Methyl-5-methyl-U CEP Usage And Synthesis |
| Uses | 2'-O-Methyl-5-methyl-U CEP is a uridine, can be used for synthesis nucleic acid. |
| | 2'-O-Methyl-5-methyl-U CEP Preparation Products And Raw materials |
|