|
|
| | 4-(Trifluoromethoxy)phenylacetylene Basic information |
| Product Name: | 4-(Trifluoromethoxy)phenylacetylene | | Synonyms: | Benzene, 1-ethynyl-4-(trifluoroMethoxy)-;1-Ethynyl-4-(trifluoromethoxy)benzene, 4-Ethynyl-alpha,alpha,alpha-trifluoroanisole;Benzene, 1-ethy;4-(Trifluoromethoxy)phenylacetylene 97%;1-Ethynyl-4-(trifluoromethoxy);4-ETHYNYL-1-(TRIFLUOROMETHOXY) BENZENE;1-ETHYNYL-4-(TRIFLUOROMETHOXY)-BENZENE;1-Ethynyl-4-(trifluoromethoxy)benzene - [E50789] | | CAS: | 160542-02-9 | | MF: | C9H5F3O | | MW: | 186.13 | | EINECS: | | | Product Categories: | | | Mol File: | 160542-02-9.mol |  |
| | 4-(Trifluoromethoxy)phenylacetylene Chemical Properties |
| Boiling point | 158.1±40.0 °C(Predicted) | | density | 1.215 g/mL at 25 °C | | refractive index | n20/D 1.4554 | | Fp | 40 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | White to Yellow to Green | | InChI | InChI=1S/C9H5F3O/c1-2-7-3-5-8(6-4-7)13-9(10,11)12/h1,3-6H | | InChIKey | RWWGGRCLMVYXPM-UHFFFAOYSA-N | | SMILES | C1(C#C)=CC=C(OC(F)(F)F)C=C1 |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 22-36-43-51/53 | | Safety Statements | 26-36/37-61 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29093090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 4-(Trifluoromethoxy)phenylacetylene Usage And Synthesis |
| | 4-(Trifluoromethoxy)phenylacetylene Preparation Products And Raw materials |
|