|
|
| | 4-Fluoro-3-phenoxybenzaldehyde Basic information |
| | 4-Fluoro-3-phenoxybenzaldehyde Chemical Properties |
| Boiling point | 310 | | density | 1.2091 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5830(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Colorless | | InChI | InChI=1S/C13H9FO2/c14-12-7-6-10(9-15)8-13(12)16-11-4-2-1-3-5-11/h1-9H | | InChIKey | JDICMOLUAHZVDS-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(F)C(OC2=CC=CC=C2)=C1 | | CAS DataBase Reference | 68359-57-9(CAS DataBase Reference) | | EPA Substance Registry System | 4-Fluoro-3-phenoxybenzaldehyde (68359-57-9) |
| Hazard Codes | Xn,N | | Risk Statements | 22-51/53 | | Safety Statements | 61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | Hazard Note | Harmful | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 29130000 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| | 4-Fluoro-3-phenoxybenzaldehyde Usage And Synthesis |
| Uses | 4-Fluoro-3-phenoxybenzaldehyde is a reactant in the preparation of ring-disubstituted propyl cyano(phenyl)propenoates which are then used as copolymers with styrene. |
| | 4-Fluoro-3-phenoxybenzaldehyde Preparation Products And Raw materials |
|