|
|
| | 3,4-Diaminofluorobenzene Basic information |
| Product Name: | 3,4-Diaminofluorobenzene | | Synonyms: | 3,4-DIAMINOFLUOROBENZENE;1,2-Diamino-4-fluorobenzene~3,4-Diaminofluorobenzene;4-FLUORO-1,2-PHENYLENEDIAMINE;4-FLUORO-1,2-DIAMINOBENZENE;4-FLUORO-BENZENE-1,2-DIAMINE;4-FLUORO-O-PHENYLENEDIAMINE;3,4-Diaminofluorobenzene 98%;3,4-Diaminofluorobenzene98% | | CAS: | 367-31-7 | | MF: | C6H7FN2 | | MW: | 126.13 | | EINECS: | 206-691-7 | | Product Categories: | Fluorine series | | Mol File: | 367-31-7.mol |  |
| | 3,4-Diaminofluorobenzene Chemical Properties |
| Melting point | 94-98 °C | | Boiling point | 266.1±20.0 °C(Predicted) | | density | 1.284±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.22±0.10(Predicted) | | color | deep brown | | Water Solubility | Slightly soluble in water. | | Sensitive | Light Sensitive | | BRN | 2081075 | | InChI | InChI=1S/C6H7FN2/c7-4-1-2-5(8)6(9)3-4/h1-3H,8-9H2 | | InChIKey | KWEWNOOZQVJONF-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(F)C=C1N | | CAS DataBase Reference | 367-31-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN2811 | | WGK Germany | 3 | | F | 8 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29215110 |
| | 3,4-Diaminofluorobenzene Usage And Synthesis |
| Chemical Properties | White to brown powder | | Uses | 4-Fluoro-o-phenylenediamine is used as pharmaceutical intermediate. | | Synthesis | General procedure for the synthesis of 4-fluoro-1,2-benzenediamine from 5-fluoro-2-nitroaniline: a methanol solution of 5-fluoro-2-nitroaniline (0.32 M) was added to a palladium/carbon catalyst (5% w/w, 10% w). The reaction mixture was stirred for 2 h at room temperature under hydrogen atmosphere (50 psi). Upon completion of the reaction, the mixture was filtered to remove the catalyst and the filtrate was concentrated to afford 4-fluoro-1,2-benzenediamine in 90% yield as a brown oil. Mass spectrometry (electrospray positive ion mode) analysis: the theoretical molecular weight of C6H7FN2 was 126 and the measured value was 127 (M + H)+. | | References | [1] Macromolecules, 2005, vol. 38, # 2, p. 297 - 306
[2] Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994, # 19, p. 2751 - 2758
[3] Patent: WO2010/13037, 2010, A1. Location in patent: Page/Page column 67
[4] Synlett, 2018, vol. 29, # 13, p. 1765 - 1768
[5] Tetrahedron, 2017, vol. 73, # 27-28, p. 3898 - 3904 |
| | 3,4-Diaminofluorobenzene Preparation Products And Raw materials |
|