- triclopyr-butotyl
-
- $0.00 / 25kg
-
2025-12-02
- CAS:64700-56-7
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 20tons
- triclopyr-butotyl
-
- $1.00 / 1KG
-
2020-02-04
- CAS:64700-56-7
- Min. Order: 1KG
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | Triclopyr 2-butoxyethyl ester Basic information |
| | Triclopyr 2-butoxyethyl ester Chemical Properties |
| Boiling point | 421.7±40.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -2.61±0.10(Predicted) | | color | Clear Colourless to Yellow | | BRN | 8155305 | | Major Application | agriculture
environmental | | InChI | InChI=1S/C13H16Cl3NO4/c1-2-3-4-19-5-6-20-11(18)8-21-13-10(15)7-9(14)12(16)17-13/h7H,2-6,8H2,1H3 | | InChIKey | IVDRCZNHVGQBHZ-UHFFFAOYSA-N | | SMILES | C(OCCOCCCC)(=O)COC1=NC(Cl)=C(Cl)C=C1Cl | | EPA Substance Registry System | Triclopyr-butotyl (64700-56-7) |
| Hazard Codes | Xn | | Risk Statements | 22-38 | | Safety Statements | 23-24/25 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | RTECS | AJ8970000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Skin Irrit. 2 |
| | Triclopyr 2-butoxyethyl ester Usage And Synthesis |
| Uses | Triclopyr Butotyl is a herbicide. It s very effective in reducing the canopy of honey mesquite. |
| | Triclopyr 2-butoxyethyl ester Preparation Products And Raw materials |
|