1-Methyl-1H-indazole-4-boronic acid pinacol ester manufacturers
|
| | 1-Methyl-1H-indazole-4-boronic acid pinacol ester Basic information |
| Product Name: | 1-Methyl-1H-indazole-4-boronic acid pinacol ester | | Synonyms: | 1-Methylindazole-4-boronic acid pinacol ester;1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole;3-hydroxy-2,3-dimethylbutan-2-yl hydrogen (1-methyl-1H-indazol-4-yl)boronate;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole;1-Methyl-1H-indazole-4-boronic acid pinacol ester;1H-Indazole, 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;1-Methyl-1H-indazole-4-boronic acid pinacol ester;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole | | CAS: | 885698-94-2 | | MF: | C14H19BN2O2 | | MW: | 258.12 | | EINECS: | | | Product Categories: | Indazole;Organoborons | | Mol File: | 885698-94-2.mol |  |
| | 1-Methyl-1H-indazole-4-boronic acid pinacol ester Chemical Properties |
| Melting point | 84-89°C | | Boiling point | 385.0±15.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 1.23±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H19BN2O2/c1-13(2)14(3,4)19-15(18-13)11-7-6-8-12-10(11)9-16-17(12)5/h6-9H,1-5H3 | | InChIKey | OZHFBNULPUBRJF-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C(B3OC(C)(C)C(C)(C)O3)=CC=C2)C=N1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Methyl-1H-indazole-4-boronic acid pinacol ester Usage And Synthesis |
| | 1-Methyl-1H-indazole-4-boronic acid pinacol ester Preparation Products And Raw materials |
|