|
|
| | Cevimeline Hydrochloride Salt Basic information |
| | Cevimeline Hydrochloride Salt Chemical Properties |
| Melting point | 195-197C | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Water:50.0(Max Conc. mg/mL);212.07(Max Conc. mM) | | form | A crystalline solid | | color | White to off-white | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H17NOS.ClH/c1-8-12-10(7-13-8)6-11-4-2-9(10)3-5-11;/h8-9H,2-7H2,1H3;1H | | InChIKey | SURWTGAXEIEOGY-UHFFFAOYSA-N | | SMILES | C1CC2C3(CSC(C)O3)CN1CC2.Cl |
| Toxicity | mouse,LD50,intravenous,33mg/kg (33mg/kg),United States Patent Document. Vol. #4855290, |
| | Cevimeline Hydrochloride Salt Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A novel muscarinic M1 and M3 receptor agonist. Sialagogue. | | Biological Activity | Selective M 1 receptor agonist. Induces atropine-sensitive contractions of isolated guinea pig ilea and trachea preparations (EC 50 values are 3.5 and 3 μ M respectively). Reverses AF64A-induced cognitive impairments in vivo . | | in vivo | Cevimeline (0.008-0.016 mg/kg; intraperitoneal injection; male Wistar rats) treatment shows slowly increasing and lasting salivation, and increased blood flow increment in the parotid gland and pressor response. Cevimeline inhibits angiotensin II-induced water intake and neuronal activity in the subfornical organ at 0.016 mg/kg[1]. | Animal Model: | Male Wistar rats (8-week-old) injected with angiotensin-II[1] | | Dosage: | 0.008 mg/kg, 0.016 mg/kg | | Administration: | Intraperitoneal injection | | Result: | Showed slowly increasing and lasting salivation, and increased blood flow increment in the parotid gland and pressor response.
|
| | IC 50 | mAChR1; mAChR3 | | storage | -20°C |
| | Cevimeline Hydrochloride Salt Preparation Products And Raw materials |
|