| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | AMMONIUM-D8 SULFATE Basic information |
| | AMMONIUM-D8 SULFATE Chemical Properties |
| Melting point | >280 °C (dec.) (lit.) | | form | solid | | InChI | 1S/2H3N.H2O4S/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4)/i/hD8 | | InChIKey | BFNBIHQBYMNNAN-KTOHAENGSA-N | | SMILES | [2H]N([2H])[2H].[2H]N([2H])[2H].[2H]OS(=O)(=O)O[2H] | | CAS Number Unlabeled | 7783-20-2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2845901000 | | Storage Class | 11 - Combustible Solids |
| | AMMONIUM-D8 SULFATE Usage And Synthesis |
| Uses | Ammonium sulphate-d8 is the deuterium labeled Ammonium sulphate,≥99.0%,AR[1]. Ammonium sulphate,≥99.0%,AR is an inorganic sulfate salt used for molecular biology[2]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 [2] DIXON M. A nomogram for ammonium sulphate solutions. Biochem J. 1953 Jun;54(3):457-8. DOI:10.1042/bj0540457 |
| | AMMONIUM-D8 SULFATE Preparation Products And Raw materials |
|